C19H25NO6 — CID 134947951
trans-diethyl (3R,4R)-3-(3-cyanobuta-1,3-dien-2-yl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 134947951) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is trans-diethyl (3R,4R)-3-(3-cyanobuta-1,3-dien-2-yl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4R)-3-(3-cyanobuta-1,3-dien-2-yl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134947951 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | trans-diethyl (3R,4R)-3-(3-cyanobuta-1,3-dien-2-yl)-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | C=C(C#N)C(=C)[C@@H]1CC(C(=O)OCC)(C(=O)OCC)C[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C19H25NO6/c1-6-25-17(22)19(18(23)26-7-2)9-14(8-16(21)24-5)15(10-19)13(4)12(3)11-20/h14-15H,3-4,6-10H2,1-2,5H3/t14-,15-/m0/s1 |
| InChIKey | LZYHVOSLZZNLDO-GJZGRUSLSA-N |
| XLogP | 2.32 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|