C22H33NO3Si — CID 134948844
(4R)-4-benzyl-3-[(1E,3Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpenta-1,3-dienyl]-1,3-oxazolidin-2-one (PubChem CID 134948844) has the molecular formula C22H33NO3Si and a molecular weight of 387.60 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(1E,3Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpenta-1,3-dienyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(1E,3Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpenta-1,3-dienyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134948844 |
| Molecular Formula | C22H33NO3Si |
| Molecular Weight | 387.60 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (4R)-4-benzyl-3-[(1E,3Z)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylpenta-1,3-dienyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C\C(C)=C(\O[Si](C)(C)C(C)(C)C)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H33NO3Si/c1-8-12-17(2)20(26-27(6,7)22(3,4)5)23-19(16-25-21(23)24)15-18-13-10-9-11-14-18/h8-14,19H,15-16H2,1-7H3/b12-8-,20-17+/t19-/m1/s1 |
| InChIKey | LZEIYVMNMCFTBI-VYWXUBOQSA-N |
| XLogP | 5.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|