C27H24FNO3 — CID 134948972
(3S,3'S)-1-benzyl-3'-butyl-3'-(4-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione (PubChem CID 134948972) has the molecular formula C27H24FNO3 and a molecular weight of 429.49 g/mol. Its IUPAC name is (3S,3'S)-1-benzyl-3'-butyl-3'-(4-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione.
| Compound Name | (3S,3'S)-1-benzyl-3'-butyl-3'-(4-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione |
|---|---|
| PubChem CID | 134948972 |
| Molecular Formula | C27H24FNO3 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (3S,3'S)-1-benzyl-3'-butyl-3'-(4-fluorophenyl)spiro[indole-3,4'-oxetane]-2,2'-dione |
| SMILES | CCCC[C@@]1(c2ccc(F)cc2)C(=O)O[C@]12C(=O)N(Cc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C27H24FNO3/c1-2-3-17-26(20-13-15-21(28)16-14-20)25(31)32-27(26)22-11-7-8-12-23(22)29(24(27)30)18-19-9-5-4-6-10-19/h4-16H,2-3,17-18H2,1H3/t26-,27-/m1/s1 |
| InChIKey | IFVCLMOMTDJXDY-KAYWLYCHSA-N |
| XLogP | 5.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|