C18H20FNO6 — CID 57407612
methyl 2-[5-fluoro-1-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-oxoindol-3-yl]prop-2-enoate (PubChem CID 57407612) has the molecular formula C18H20FNO6 and a molecular weight of 365.36 g/mol. Its IUPAC name is methyl 2-[5-fluoro-1-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-oxoindol-3-yl]prop-2-enoate.
| Compound Name | methyl 2-[5-fluoro-1-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-oxoindol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 57407612 |
| Molecular Formula | C18H20FNO6 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | methyl 2-[5-fluoro-1-methyl-3-[(2-methylpropan-2-yl)oxycarbonyloxy]-2-oxoindol-3-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1(OC(=O)OC(C)(C)C)C(=O)N(C)c2ccc(F)cc21 |
| InChI | InChI=1S/C18H20FNO6/c1-10(14(21)24-6)18(26-16(23)25-17(2,3)4)12-9-11(19)7-8-13(12)20(5)15(18)22/h7-9H,1H2,2-6H3 |
| InChIKey | JJKIPGIPYMZCFA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|