C22H32N2O2 — CID 134949829
tert-butyl 4-(2,3-diethyl-1H-inden-1-yl)piperazine-1-carboxylate (PubChem CID 134949829) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl 4-(2,3-diethyl-1H-inden-1-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,3-diethyl-1H-inden-1-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134949829 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tert-butyl 4-(2,3-diethyl-1H-inden-1-yl)piperazine-1-carboxylate |
| SMILES | CCC1=C(CC)C(N2CCN(C(=O)OC(C)(C)C)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H32N2O2/c1-6-16-17(7-2)20(19-11-9-8-10-18(16)19)23-12-14-24(15-13-23)21(25)26-22(3,4)5/h8-11,20H,6-7,12-15H2,1-5H3 |
| InChIKey | GJRHOTRLTXDKMD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |