C13H25NO3Si — CID 134950181
(4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-ethenyl-1,3-oxazolidin-2-one (PubChem CID 134950181) has the molecular formula C13H25NO3Si and a molecular weight of 271.43 g/mol. Its IUPAC name is (4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134950181 |
| Molecular Formula | C13H25NO3Si |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (4R,5S)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-5-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1OC(=O)N[C@H]1[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO3Si/c1-8-10-11(14-12(15)16-10)9(2)17-18(6,7)13(3,4)5/h8-11H,1H2,2-7H3,(H,14,15)/t9-,10-,11-/m0/s1 |
| InChIKey | OPOHBMLYVIUYIJ-DCAQKATOSA-N |
| XLogP | 3.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|