C30H25F3O4S — CID 134951417
[4-[(E)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-phenylbut-3-en-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 134951417) has the molecular formula C30H25F3O4S and a molecular weight of 538.59 g/mol. Its IUPAC name is [4-[(E)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-phenylbut-3-en-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(E)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-phenylbut-3-en-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134951417 |
| Molecular Formula | C30H25F3O4S |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | [4-[(E)-1,1,1-trifluoro-4-(4-methoxyphenyl)-4-phenylbut-3-en-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/C(=C/C(c2ccc(OS(=O)(=O)c3ccc(C)cc3)cc2)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25F3O4S/c1-21-8-18-27(19-9-21)38(34,35)37-26-16-12-24(13-17-26)29(30(31,32)33)20-28(22-6-4-3-5-7-22)23-10-14-25(36-2)15-11-23/h3-20,29H,1-2H3/b28-20+ |
| InChIKey | IIAXUGUWKCEMPF-VFCFBJKWSA-N |
| XLogP | 7.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|