C40H54F3NO2Si2 — CID 134952003
3-[(2R,5R)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 134952003) has the molecular formula C40H54F3NO2Si2 and a molecular weight of 694.04 g/mol. Its IUPAC name is 3-[(2R,5R)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[(2R,5R)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134952003 |
| Molecular Formula | C40H54F3NO2Si2 |
| Molecular Weight | 694.04 g/mol |
| Exact Mass | 693.36 |
| IUPAC Name | 3-[(2R,5R)-3-benzyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN(Cc2ccccc2)[C@@H](C(F)(F)F)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H54F3NO2Si2/c1-31(2)47(32(3)4,33(5)6)27-19-26-39(29-44(37(46-39)40(41,42)43)28-34-20-13-10-14-21-34)30-45-48(38(7,8)9,35-22-15-11-16-23-35)36-24-17-12-18-25-36/h10-18,20-25,31-33,37H,26,28-30H2,1-9H3/t37-,39-/m1/s1 |
| InChIKey | NXNAVWADCDCJRW-XCEDALPCSA-N |
| XLogP | 9.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.04 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|