C24H36F3NOSi — CID 134952002
3-[(2R,5R)-3-benzyl-5-methyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 134952002) has the molecular formula C24H36F3NOSi and a molecular weight of 439.64 g/mol. Its IUPAC name is 3-[(2R,5R)-3-benzyl-5-methyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[(2R,5R)-3-benzyl-5-methyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134952002 |
| Molecular Formula | C24H36F3NOSi |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 3-[(2R,5R)-3-benzyl-5-methyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC[C@]1(C)CN(Cc2ccccc2)[C@@H](C(F)(F)F)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H36F3NOSi/c1-18(2)30(19(3)4,20(5)6)15-11-14-23(7)17-28(22(29-23)24(25,26)27)16-21-12-9-8-10-13-21/h8-10,12-13,18-20,22H,14,16-17H2,1-7H3/t22-,23-/m1/s1 |
| InChIKey | OVSMKFJIRPBGGM-DHIUTWEWSA-N |
| XLogP | 6.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|