C23H36F3NOSi — CID 122219645
3-[(2R,5R)-3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-en-2-yl-tri(propan-2-yl)silane (PubChem CID 122219645) has the molecular formula C23H36F3NOSi and a molecular weight of 427.63 g/mol. Its IUPAC name is 3-[(2R,5R)-3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-en-2-yl-tri(propan-2-yl)silane.
| Compound Name | 3-[(2R,5R)-3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-en-2-yl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 122219645 |
| Molecular Formula | C23H36F3NOSi |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[(2R,5R)-3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-en-2-yl-tri(propan-2-yl)silane |
| SMILES | C=C(C[C@@H]1CN(Cc2ccccc2)[C@@H](C(F)(F)F)O1)[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36F3NOSi/c1-16(2)29(17(3)4,18(5)6)19(7)13-21-15-27(22(28-21)23(24,25)26)14-20-11-9-8-10-12-20/h8-12,16-18,21-22H,7,13-15H2,1-6H3/t21-,22-/m1/s1 |
| InChIKey | BFSKRDTXKWMFCM-FGZHOGPDSA-N |
| XLogP | 6.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|