C18H28F3NO2Si — CID 10571524
[1-(1-benzylpyrrolidin-2-yl)-1-ethoxy-2,2,2-trifluoroethoxy]-trimethylsilane (PubChem CID 10571524) has the molecular formula C18H28F3NO2Si and a molecular weight of 375.51 g/mol. Its IUPAC name is [1-(1-benzylpyrrolidin-2-yl)-1-ethoxy-2,2,2-trifluoroethoxy]-trimethylsilane.
| Compound Name | [1-(1-benzylpyrrolidin-2-yl)-1-ethoxy-2,2,2-trifluoroethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10571524 |
| Molecular Formula | C18H28F3NO2Si |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [1-(1-benzylpyrrolidin-2-yl)-1-ethoxy-2,2,2-trifluoroethoxy]-trimethylsilane |
| SMILES | CCOC(O[Si](C)(C)C)(C1CCCN1Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H28F3NO2Si/c1-5-23-17(18(19,20)21,24-25(2,3)4)16-12-9-13-22(16)14-15-10-7-6-8-11-15/h6-8,10-11,16H,5,9,12-14H2,1-4H3 |
| InChIKey | OOOWSPHZZIUOJI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|