C18H30FNOSi — CID 23630780
[(3R,5R)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 23630780) has the molecular formula C18H30FNOSi and a molecular weight of 323.53 g/mol. Its IUPAC name is [(3R,5R)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,5R)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23630780 |
| Molecular Formula | C18H30FNOSi |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [(3R,5R)-1-benzyl-5-(fluoromethyl)pyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](CF)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H30FNOSi/c1-18(2,3)22(4,5)21-17-11-16(12-19)20(14-17)13-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | SCUYCLNBFABQSX-IAGOWNOFSA-N |
| XLogP | 4.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|