C18H16F3NO — CID 162411830
(5Z)-3-benzyl-5-benzylidene-2-(trifluoromethyl)-1,3-oxazolidine (PubChem CID 162411830) has the molecular formula C18H16F3NO and a molecular weight of 319.33 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-benzylidene-2-(trifluoromethyl)-1,3-oxazolidine.
| Compound Name | (5Z)-3-benzyl-5-benzylidene-2-(trifluoromethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 162411830 |
| Molecular Formula | C18H16F3NO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (5Z)-3-benzyl-5-benzylidene-2-(trifluoromethyl)-1,3-oxazolidine |
| SMILES | FC(F)(F)C1O/C(=C\c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H16F3NO/c19-18(20,21)17-22(12-15-9-5-2-6-10-15)13-16(23-17)11-14-7-3-1-4-8-14/h1-11,17H,12-13H2/b16-11- |
| InChIKey | HYQAZDPVZOLGOQ-WJDWOHSUSA-N |
| XLogP | 4.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |