C24H34F3NOSi — CID 162411823
[(3E)-3-[3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-ylidene]but-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 162411823) has the molecular formula C24H34F3NOSi and a molecular weight of 437.62 g/mol. Its IUPAC name is [(3E)-3-[3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-ylidene]but-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3E)-3-[3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-ylidene]but-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 162411823 |
| Molecular Formula | C24H34F3NOSi |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | [(3E)-3-[3-benzyl-2-(trifluoromethyl)-1,3-oxazolidin-5-ylidene]but-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C1/CN(Cc2ccccc2)C(C(F)(F)F)O1 |
| InChI | InChI=1S/C24H34F3NOSi/c1-17(2)30(18(3)4,19(5)6)14-13-20(7)22-16-28(23(29-22)24(25,26)27)15-21-11-9-8-10-12-21/h8-12,17-19,23H,15-16H2,1-7H3/b22-20+ |
| InChIKey | RHVYBQQTQNTURB-LSDHQDQOSA-N |
| XLogP | 6.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|