C23H33NO2Si — CID 162411824
(5E)-3-benzyl-5-[4-tri(propan-2-yl)silylbut-3-yn-2-ylidene]-1,3-oxazolidin-2-one (PubChem CID 162411824) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[4-tri(propan-2-yl)silylbut-3-yn-2-ylidene]-1,3-oxazolidin-2-one.
| Compound Name | (5E)-3-benzyl-5-[4-tri(propan-2-yl)silylbut-3-yn-2-ylidene]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162411824 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (5E)-3-benzyl-5-[4-tri(propan-2-yl)silylbut-3-yn-2-ylidene]-1,3-oxazolidin-2-one |
| SMILES | C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C1/CN(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C23H33NO2Si/c1-17(2)27(18(3)4,19(5)6)14-13-20(7)22-16-24(23(25)26-22)15-21-11-9-8-10-12-21/h8-12,17-19H,15-16H2,1-7H3/b22-20+ |
| InChIKey | AUWRVJUSSMZLMA-LSDHQDQOSA-N |
| XLogP | 6.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|