C24H33F6NOSi — CID 122219646
tri(propan-2-yl)-[3-[2-(trifluoromethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-5-yl]prop-1-ynyl]silane (PubChem CID 122219646) has the molecular formula C24H33F6NOSi and a molecular weight of 493.61 g/mol. Its IUPAC name is tri(propan-2-yl)-[3-[2-(trifluoromethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-5-yl]prop-1-ynyl]silane.
| Compound Name | tri(propan-2-yl)-[3-[2-(trifluoromethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-5-yl]prop-1-ynyl]silane |
|---|---|
| PubChem CID | 122219646 |
| Molecular Formula | C24H33F6NOSi |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | tri(propan-2-yl)-[3-[2-(trifluoromethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-oxazolidin-5-yl]prop-1-ynyl]silane |
| SMILES | CC(C)[Si](C#CCC1CN(Cc2ccc(C(F)(F)F)cc2)C(C(F)(F)F)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H33F6NOSi/c1-16(2)33(17(3)4,18(5)6)13-7-8-21-15-31(22(32-21)24(28,29)30)14-19-9-11-20(12-10-19)23(25,26)27/h9-12,16-18,21-22H,8,14-15H2,1-6H3 |
| InChIKey | JOKCRNWKZLPTNM-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|