C15H14F3NO — CID 162411825
(5E)-3-benzyl-5-but-3-yn-2-ylidene-2-(trifluoromethyl)-1,3-oxazolidine (PubChem CID 162411825) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is (5E)-3-benzyl-5-but-3-yn-2-ylidene-2-(trifluoromethyl)-1,3-oxazolidine.
| Compound Name | (5E)-3-benzyl-5-but-3-yn-2-ylidene-2-(trifluoromethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 162411825 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (5E)-3-benzyl-5-but-3-yn-2-ylidene-2-(trifluoromethyl)-1,3-oxazolidine |
| SMILES | C#C/C(C)=C1\CN(Cc2ccccc2)C(C(F)(F)F)O1 |
| InChI | InChI=1S/C15H14F3NO/c1-3-11(2)13-10-19(14(20-13)15(16,17)18)9-12-7-5-4-6-8-12/h1,4-8,14H,9-10H2,2H3/b13-11+ |
| InChIKey | FMBAHSHOTQIQKZ-ACCUITESSA-N |
| XLogP | 3.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|