C21H32F3NOSi — CID 123358299
[5-(2,6-dimethylmorpholin-4-yl)-5-[4-(trifluoromethyl)phenyl]pentyl]-ethenyl-methylsilane (PubChem CID 123358299) has the molecular formula C21H32F3NOSi and a molecular weight of 399.57 g/mol. Its IUPAC name is [5-(2,6-dimethylmorpholin-4-yl)-5-[4-(trifluoromethyl)phenyl]pentyl]-ethenyl-methylsilane.
| Compound Name | [5-(2,6-dimethylmorpholin-4-yl)-5-[4-(trifluoromethyl)phenyl]pentyl]-ethenyl-methylsilane |
|---|---|
| PubChem CID | 123358299 |
| Molecular Formula | C21H32F3NOSi |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | [5-(2,6-dimethylmorpholin-4-yl)-5-[4-(trifluoromethyl)phenyl]pentyl]-ethenyl-methylsilane |
| SMILES | C=C[SiH](C)CCCCC(c1ccc(C(F)(F)F)cc1)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C21H32F3NOSi/c1-5-27(4)13-7-6-8-20(25-14-16(2)26-17(3)15-25)18-9-11-19(12-10-18)21(22,23)24/h5,9-12,16-17,20,27H,1,6-8,13-15H2,2-4H3 |
| InChIKey | LEZZEYRRNZRMRA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|