C23H39NO3Si — CID 134952663
tert-butyl N-[(E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-phenylpent-4-en-2-yl]carbamate (PubChem CID 134952663) has the molecular formula C23H39NO3Si and a molecular weight of 405.66 g/mol. Its IUPAC name is tert-butyl N-[(E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-phenylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-phenylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134952663 |
| Molecular Formula | C23H39NO3Si |
| Molecular Weight | 405.66 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | tert-butyl N-[(E,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-phenylpent-4-en-2-yl]carbamate |
| SMILES | C/C(=C\c1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H39NO3Si/c1-17(16-19-14-12-11-13-15-19)20(27-28(9,10)23(6,7)8)18(2)24-21(25)26-22(3,4)5/h11-16,18,20H,1-10H3,(H,24,25)/b17-16+/t18-,20-/m1/s1 |
| InChIKey | ROYFZTQRQCYFLL-DPBVHHOFSA-N |
| XLogP | 6.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|