C24H25NO3S — CID 134953520
(2S,3R,5S)-3-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenylmorpholine (PubChem CID 134953520) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is (2S,3R,5S)-3-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenylmorpholine.
| Compound Name | (2S,3R,5S)-3-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenylmorpholine |
|---|---|
| PubChem CID | 134953520 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (2S,3R,5S)-3-methyl-4-(4-methylphenyl)sulfonyl-2,5-diphenylmorpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](c3ccccc3)CO[C@@H](c3ccccc3)[C@H]2C)cc1 |
| InChI | InChI=1S/C24H25NO3S/c1-18-13-15-22(16-14-18)29(26,27)25-19(2)24(21-11-7-4-8-12-21)28-17-23(25)20-9-5-3-6-10-20/h3-16,19,23-24H,17H2,1-2H3/t19-,23-,24-/m1/s1 |
| InChIKey | QYTIIOXEWCISLH-CTUHWIOQSA-N |
| XLogP | 4.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |