C39H55N3O6S2 — CID 3011742
9-benzyl-1,5-bis[[4-(butoxymethyl)phenyl]sulfonyl]-3-methylidene-1,5,9-triazacyclododecane (PubChem CID 3011742) has the molecular formula C39H55N3O6S2 and a molecular weight of 726.02 g/mol. Its IUPAC name is 9-benzyl-1,5-bis[[4-(butoxymethyl)phenyl]sulfonyl]-3-methylidene-1,5,9-triazacyclododecane.
| Compound Name | 9-benzyl-1,5-bis[[4-(butoxymethyl)phenyl]sulfonyl]-3-methylidene-1,5,9-triazacyclododecane |
|---|---|
| PubChem CID | 3011742 |
| Molecular Formula | C39H55N3O6S2 |
| Molecular Weight | 726.02 g/mol |
| Exact Mass | 725.35 |
| IUPAC Name | 9-benzyl-1,5-bis[[4-(butoxymethyl)phenyl]sulfonyl]-3-methylidene-1,5,9-triazacyclododecane |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(COCCCC)cc2)CCCN(Cc2ccccc2)CCCN(S(=O)(=O)c2ccc(COCCCC)cc2)C1 |
| InChI | InChI=1S/C39H55N3O6S2/c1-4-6-27-47-32-36-15-19-38(20-16-36)49(43,44)41-25-11-23-40(31-35-13-9-8-10-14-35)24-12-26-42(30-34(3)29-41)50(45,46)39-21-17-37(18-22-39)33-48-28-7-5-2/h8-10,13-22H,3-7,11-12,23-33H2,1-2H3 |
| InChIKey | VDHZWMRLZDJLTN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.02 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|