C21H25F3O4S — CID 134954279
[(6R)-7,7,7-trifluoro-6-(3-methoxyphenyl)heptyl] 4-methylbenzenesulfonate (PubChem CID 134954279) has the molecular formula C21H25F3O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is [(6R)-7,7,7-trifluoro-6-(3-methoxyphenyl)heptyl] 4-methylbenzenesulfonate.
| Compound Name | [(6R)-7,7,7-trifluoro-6-(3-methoxyphenyl)heptyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134954279 |
| Molecular Formula | C21H25F3O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [(6R)-7,7,7-trifluoro-6-(3-methoxyphenyl)heptyl] 4-methylbenzenesulfonate |
| SMILES | COc1cccc([C@@H](CCCCCOS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H25F3O4S/c1-16-10-12-19(13-11-16)29(25,26)28-14-5-3-4-9-20(21(22,23)24)17-7-6-8-18(15-17)27-2/h6-8,10-13,15,20H,3-5,9,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | IDAXHDPSPIYCBX-HXUWFJFHSA-N |
| XLogP | 5.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|