C18H17F3O5S — CID 15261500
[(E)-3,4,4-trifluoro-1-hydroxy-1-(4-methoxyphenyl)but-2-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 15261500) has the molecular formula C18H17F3O5S and a molecular weight of 402.39 g/mol. Its IUPAC name is [(E)-3,4,4-trifluoro-1-hydroxy-1-(4-methoxyphenyl)but-2-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-3,4,4-trifluoro-1-hydroxy-1-(4-methoxyphenyl)but-2-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15261500 |
| Molecular Formula | C18H17F3O5S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [(E)-3,4,4-trifluoro-1-hydroxy-1-(4-methoxyphenyl)but-2-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(O)/C(OS(=O)(=O)c2ccc(C)cc2)=C(\F)C(F)F)cc1 |
| InChI | InChI=1S/C18H17F3O5S/c1-11-3-9-14(10-4-11)27(23,24)26-17(15(19)18(20)21)16(22)12-5-7-13(25-2)8-6-12/h3-10,16,18,22H,1-2H3/b17-15+ |
| InChIKey | OKPAEAUOZYBYTJ-BMRADRMJSA-N |
| XLogP | 3.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|