C24H28N2O2 — CID 134955080
(2R,3S)-3-(benzhydrylideneamino)-2-methyl-1-morpholin-4-ylhex-5-en-1-one (PubChem CID 134955080) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (2R,3S)-3-(benzhydrylideneamino)-2-methyl-1-morpholin-4-ylhex-5-en-1-one.
| Compound Name | (2R,3S)-3-(benzhydrylideneamino)-2-methyl-1-morpholin-4-ylhex-5-en-1-one |
|---|---|
| PubChem CID | 134955080 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2R,3S)-3-(benzhydrylideneamino)-2-methyl-1-morpholin-4-ylhex-5-en-1-one |
| SMILES | C=CC[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H28N2O2/c1-3-10-22(19(2)24(27)26-15-17-28-18-16-26)25-23(20-11-6-4-7-12-20)21-13-8-5-9-14-21/h3-9,11-14,19,22H,1,10,15-18H2,2H3/t19-,22+/m1/s1 |
| InChIKey | QMRWAUDZQTYMPF-KNQAVFIVSA-N |
| XLogP | 3.96 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|