C27H28N2O — CID 134955118
(2R,3S)-3-(benzhydrylideneamino)-N,N-dimethyl-2-phenylhex-5-enamide (PubChem CID 134955118) has the molecular formula C27H28N2O and a molecular weight of 396.53 g/mol. Its IUPAC name is (2R,3S)-3-(benzhydrylideneamino)-N,N-dimethyl-2-phenylhex-5-enamide.
| Compound Name | (2R,3S)-3-(benzhydrylideneamino)-N,N-dimethyl-2-phenylhex-5-enamide |
|---|---|
| PubChem CID | 134955118 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2R,3S)-3-(benzhydrylideneamino)-N,N-dimethyl-2-phenylhex-5-enamide |
| SMILES | C=CC[C@H](N=C(c1ccccc1)c1ccccc1)[C@H](C(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O/c1-4-14-24(25(27(30)29(2)3)21-15-8-5-9-16-21)28-26(22-17-10-6-11-18-22)23-19-12-7-13-20-23/h4-13,15-20,24-25H,1,14H2,2-3H3/t24-,25+/m0/s1 |
| InChIKey | IOONKWUSRORNES-LOSJGSFVSA-N |
| XLogP | 5.34 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|