C16H18BrNO4S — CID 134955694
cis-tert-butyl (1S,2S)-2-(benzenesulfonylmethyl)-2-bromo-1-cyanocyclopropane-1-carboxylate (PubChem CID 134955694) has the molecular formula C16H18BrNO4S and a molecular weight of 400.29 g/mol. Its IUPAC name is cis-tert-butyl (1S,2S)-2-(benzenesulfonylmethyl)-2-bromo-1-cyanocyclopropane-1-carboxylate.
| Compound Name | cis-tert-butyl (1S,2S)-2-(benzenesulfonylmethyl)-2-bromo-1-cyanocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134955694 |
| Molecular Formula | C16H18BrNO4S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | cis-tert-butyl (1S,2S)-2-(benzenesulfonylmethyl)-2-bromo-1-cyanocyclopropane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1(C#N)C[C@@]1(Br)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18BrNO4S/c1-14(2,3)22-13(19)15(10-18)9-16(15,17)11-23(20,21)12-7-5-4-6-8-12/h4-8H,9,11H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | KVZCEUWBTJLREQ-JKSUJKDBSA-N |
| XLogP | 2.85 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|