C29H27NO3S — CID 134955756
(1S,3'S)-3'-ethenyl-1'-(4-methylphenyl)sulfonyl-6-phenylspiro[naphthalene-1,4'-piperidine]-2-one (PubChem CID 134955756) has the molecular formula C29H27NO3S and a molecular weight of 469.61 g/mol. Its IUPAC name is (1S,3'S)-3'-ethenyl-1'-(4-methylphenyl)sulfonyl-6-phenylspiro[naphthalene-1,4'-piperidine]-2-one.
| Compound Name | (1S,3'S)-3'-ethenyl-1'-(4-methylphenyl)sulfonyl-6-phenylspiro[naphthalene-1,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 134955756 |
| Molecular Formula | C29H27NO3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (1S,3'S)-3'-ethenyl-1'-(4-methylphenyl)sulfonyl-6-phenylspiro[naphthalene-1,4'-piperidine]-2-one |
| SMILES | C=C[C@@H]1CN(S(=O)(=O)c2ccc(C)cc2)CC[C@]12C(=O)C=Cc1cc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C29H27NO3S/c1-3-25-20-30(34(32,33)26-13-9-21(2)10-14-26)18-17-29(25)27-15-11-23(22-7-5-4-6-8-22)19-24(27)12-16-28(29)31/h3-16,19,25H,1,17-18,20H2,2H3/t25-,29+/m1/s1 |
| InChIKey | UVGFOBQDQINXGD-IRPSRAIASA-N |
| XLogP | 5.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|