C20H19NO3 — CID 134955775
4',6'-dimethoxy-2',3'-dimethylspiro[2H-isoindole-3,1'-indene]-1-one (PubChem CID 134955775) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4',6'-dimethoxy-2',3'-dimethylspiro[2H-isoindole-3,1'-indene]-1-one.
| Compound Name | 4',6'-dimethoxy-2',3'-dimethylspiro[2H-isoindole-3,1'-indene]-1-one |
|---|---|
| PubChem CID | 134955775 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4',6'-dimethoxy-2',3'-dimethylspiro[2H-isoindole-3,1'-indene]-1-one |
| SMILES | COc1cc(OC)c2c(c1)C1(NC(=O)c3ccccc31)C(C)=C2C |
| InChI | InChI=1S/C20H19NO3/c1-11-12(2)20(15-8-6-5-7-14(15)19(22)21-20)16-9-13(23-3)10-17(24-4)18(11)16/h5-10H,1-4H3,(H,21,22) |
| InChIKey | KDNQKEGQAUDEEV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |