C24H18N2O2 — CID 1349558
(2R,7R)-4-phenyl-4,5-diazapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaene-3,6-dione (PubChem CID 1349558) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is (2R,7R)-4-phenyl-4,5-diazapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaene-3,6-dione.
| Compound Name | (2R,7R)-4-phenyl-4,5-diazapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaene-3,6-dione |
|---|---|
| PubChem CID | 1349558 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | (2R,7R)-4-phenyl-4,5-diazapentacyclo[6.6.6.02,7.09,14.015,20]icosa-9,11,13,15,17,19-hexaene-3,6-dione |
| SMILES | O=C1NN(c2ccccc2)C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]12 |
| InChI | InChI=1S/C24H18N2O2/c27-23-21-19-15-10-4-6-12-17(15)20(18-13-7-5-11-16(18)19)22(21)24(28)26(25-23)14-8-2-1-3-9-14/h1-13,19-22H,(H,25,27)/t19?,20?,21-,22-/m1/s1 |
| InChIKey | LHPUJOVDVWHOGP-LIKPIUCQSA-N |
| XLogP | 3.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |