C24H27NO3S — CID 134955830
[(2R,3R,3aR,7aR)-3-ethenyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-phenylmethanone (PubChem CID 134955830) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is [(2R,3R,3aR,7aR)-3-ethenyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-phenylmethanone.
| Compound Name | [(2R,3R,3aR,7aR)-3-ethenyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 134955830 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [(2R,3R,3aR,7aR)-3-ethenyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-yl]-phenylmethanone |
| SMILES | C=C[C@@H]1[C@H]2CCCC[C@H]2N(S(=O)(=O)c2ccc(C)cc2)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO3S/c1-3-20-21-11-7-8-12-22(21)25(23(20)24(26)18-9-5-4-6-10-18)29(27,28)19-15-13-17(2)14-16-19/h3-6,9-10,13-16,20-23H,1,7-8,11-12H2,2H3/t20-,21-,22-,23-/m1/s1 |
| InChIKey | UIDNPGVDLMYUHW-SSGKUCQKSA-N |
| XLogP | 4.61 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|