C20H24O3 — CID 134956147
(5aS,9aS)-3,6,6,9a-tetramethyl-3,5,5a,7,8,9-hexahydronaphtho[2,1-e][1]benzofuran-2,4-dione (PubChem CID 134956147) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (5aS,9aS)-3,6,6,9a-tetramethyl-3,5,5a,7,8,9-hexahydronaphtho[2,1-e][1]benzofuran-2,4-dione.
| Compound Name | (5aS,9aS)-3,6,6,9a-tetramethyl-3,5,5a,7,8,9-hexahydronaphtho[2,1-e][1]benzofuran-2,4-dione |
|---|---|
| PubChem CID | 134956147 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (5aS,9aS)-3,6,6,9a-tetramethyl-3,5,5a,7,8,9-hexahydronaphtho[2,1-e][1]benzofuran-2,4-dione |
| SMILES | CC1C(=O)Oc2ccc3c(c21)C(=O)C[C@H]1C(C)(C)CCC[C@]31C |
| InChI | InChI=1S/C20H24O3/c1-11-16-14(23-18(11)22)7-6-12-17(16)13(21)10-15-19(2,3)8-5-9-20(12,15)4/h6-7,11,15H,5,8-10H2,1-4H3/t11?,15-,20+/m0/s1 |
| InChIKey | QRHOJMGUCGNKBC-MMDBXUTCSA-N |
| XLogP | 4.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|