C19H24O3 — CID 638511
(4aR,10aR)-8-acetyl-6-hydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one (PubChem CID 638511) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (4aR,10aR)-8-acetyl-6-hydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one.
| Compound Name | (4aR,10aR)-8-acetyl-6-hydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 638511 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (4aR,10aR)-8-acetyl-6-hydroxy-1,1,4a-trimethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
| SMILES | CC(=O)c1cc(O)cc2c1C(=O)C[C@@H]1C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C19H24O3/c1-11(20)13-8-12(21)9-14-17(13)15(22)10-16-18(2,3)6-5-7-19(14,16)4/h8-9,16,21H,5-7,10H2,1-4H3/t16-,19+/m1/s1 |
| InChIKey | UHNLEGMDPBYKCQ-APWZRJJASA-N |
| XLogP | 4.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |