C18H25NO2 — CID 134956401
N-[(1S)-1-cyclohexylbut-3-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 134956401) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexylbut-3-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(1S)-1-cyclohexylbut-3-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 134956401 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-[(1S)-1-cyclohexylbut-3-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | C=CC[C@H](Nc1ccc2c(c1)OCCO2)C1CCCCC1 |
| InChI | InChI=1S/C18H25NO2/c1-2-6-16(14-7-4-3-5-8-14)19-15-9-10-17-18(13-15)21-12-11-20-17/h2,9-10,13-14,16,19H,1,3-8,11-12H2/t16-/m0/s1 |
| InChIKey | QFEXPUYLZXZSKP-INIZCTEOSA-N |
| XLogP | 4.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|