C21H20N4O — CID 134956465
(1R,4S,12S,13S)-17-oxo-5,14-diazahexacyclo[12.4.3.01,13.04,12.06,11.012,16]henicosa-6,8,10-triene-4,16-dicarbonitrile (PubChem CID 134956465) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is (1R,4S,12S,13S)-17-oxo-5,14-diazahexacyclo[12.4.3.01,13.04,12.06,11.012,16]henicosa-6,8,10-triene-4,16-dicarbonitrile.
| Compound Name | (1R,4S,12S,13S)-17-oxo-5,14-diazahexacyclo[12.4.3.01,13.04,12.06,11.012,16]henicosa-6,8,10-triene-4,16-dicarbonitrile |
|---|---|
| PubChem CID | 134956465 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (1R,4S,12S,13S)-17-oxo-5,14-diazahexacyclo[12.4.3.01,13.04,12.06,11.012,16]henicosa-6,8,10-triene-4,16-dicarbonitrile |
| SMILES | N#CC12CN3CCC[C@@]4(CC[C@]5(C#N)Nc6ccccc6[C@@]15[C@@H]34)CC2=O |
| InChI | InChI=1S/C21H20N4O/c22-11-19-13-25-9-3-6-18(10-16(19)26)7-8-20(12-23)21(19,17(18)25)14-4-1-2-5-15(14)24-20/h1-2,4-5,17,24H,3,6-10,13H2/t17-,18+,19?,20+,21+/m0/s1 |
| InChIKey | YSJOYMLTEWOKNR-POFDQXHJSA-N |
| XLogP | 2.35 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |