C19H20N2O2 — CID 101287753
(1S,9R,16S,21S)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-13,18-dione (PubChem CID 101287753) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (1S,9R,16S,21S)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-13,18-dione.
| Compound Name | (1S,9R,16S,21S)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-13,18-dione |
|---|---|
| PubChem CID | 101287753 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (1S,9R,16S,21S)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-13,18-dione |
| SMILES | O=C1CC[C@]23CC[C@@]4(Nc5ccccc5[C@@]45CCN1[C@@H]25)C(=O)C3 |
| InChI | InChI=1S/C19H20N2O2/c22-14-11-17-6-5-15(23)21-10-9-18(16(17)21)12-3-1-2-4-13(12)20-19(14,18)8-7-17/h1-4,16,20H,5-11H2/t16-,17+,18+,19+/m0/s1 |
| InChIKey | GWWNDFWCTVBBBM-WJFTUGDTSA-N |
| XLogP | 2.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |