C27H40O8 — CID 134956942
dimethyl (6R,8aR)-6-(2,2-dimethylpropanoyloxy)-5-(2,2-dimethylpropanoyloxymethyl)-5,8a-dimethyl-3,6,7,8-tetrahydronaphthalene-1,2-dicarboxylate (PubChem CID 134956942) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is dimethyl (6R,8aR)-6-(2,2-dimethylpropanoyloxy)-5-(2,2-dimethylpropanoyloxymethyl)-5,8a-dimethyl-3,6,7,8-tetrahydronaphthalene-1,2-dicarboxylate.
| Compound Name | dimethyl (6R,8aR)-6-(2,2-dimethylpropanoyloxy)-5-(2,2-dimethylpropanoyloxymethyl)-5,8a-dimethyl-3,6,7,8-tetrahydronaphthalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134956942 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | dimethyl (6R,8aR)-6-(2,2-dimethylpropanoyloxy)-5-(2,2-dimethylpropanoyloxymethyl)-5,8a-dimethyl-3,6,7,8-tetrahydronaphthalene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(C)CC[C@@H](OC(=O)C(C)(C)C)C(C)(COC(=O)C(C)(C)C)C2=CC1 |
| InChI | InChI=1S/C27H40O8/c1-24(2,3)22(30)34-15-27(8)17-12-11-16(20(28)32-9)19(21(29)33-10)26(17,7)14-13-18(27)35-23(31)25(4,5)6/h12,18H,11,13-15H2,1-10H3/t18-,26-,27?/m1/s1 |
| InChIKey | JNWVHDSQLGOBPN-GLHWWCGNSA-N |
| XLogP | 4.31 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|