C16H18F2INO3 — CID 134957730
tert-butyl N-[(2R,3S,5Z)-2-(2,5-difluorophenyl)-5-(iodomethylidene)oxolan-3-yl]carbamate (PubChem CID 134957730) has the molecular formula C16H18F2INO3 and a molecular weight of 437.22 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,5Z)-2-(2,5-difluorophenyl)-5-(iodomethylidene)oxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,5Z)-2-(2,5-difluorophenyl)-5-(iodomethylidene)oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 134957730 |
| Molecular Formula | C16H18F2INO3 |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | tert-butyl N-[(2R,3S,5Z)-2-(2,5-difluorophenyl)-5-(iodomethylidene)oxolan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C/C(=C/I)O[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C16H18F2INO3/c1-16(2,3)23-15(21)20-13-7-10(8-19)22-14(13)11-6-9(17)4-5-12(11)18/h4-6,8,13-14H,7H2,1-3H3,(H,20,21)/b10-8-/t13-,14+/m0/s1 |
| InChIKey | JRDKLBPGWKWMPR-WWMKKXEUSA-N |
| XLogP | 4.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|