C20H20O2 — CID 134957797
(3R,3'R)-3'-phenylspiro[1,4-dihydronaphthalene-3,2'-oxane]-2-one (PubChem CID 134957797) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3R,3'R)-3'-phenylspiro[1,4-dihydronaphthalene-3,2'-oxane]-2-one.
| Compound Name | (3R,3'R)-3'-phenylspiro[1,4-dihydronaphthalene-3,2'-oxane]-2-one |
|---|---|
| PubChem CID | 134957797 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (3R,3'R)-3'-phenylspiro[1,4-dihydronaphthalene-3,2'-oxane]-2-one |
| SMILES | O=C1Cc2ccccc2C[C@]12OCCC[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C20H20O2/c21-19-13-16-9-4-5-10-17(16)14-20(19)18(11-6-12-22-20)15-7-2-1-3-8-15/h1-5,7-10,18H,6,11-14H2/t18-,20-/m1/s1 |
| InChIKey | CWVFZRUMJWWXKK-UYAOXDASSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |