C26H29FO3 — CID 90958385
4-[2-ethyl-4-(4-fluorophenyl)phenyl]-2,2-dimethyl-1-oxaspiro[5.5]undecane-3,5-dione (PubChem CID 90958385) has the molecular formula C26H29FO3 and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-[2-ethyl-4-(4-fluorophenyl)phenyl]-2,2-dimethyl-1-oxaspiro[5.5]undecane-3,5-dione.
| Compound Name | 4-[2-ethyl-4-(4-fluorophenyl)phenyl]-2,2-dimethyl-1-oxaspiro[5.5]undecane-3,5-dione |
|---|---|
| PubChem CID | 90958385 |
| Molecular Formula | C26H29FO3 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 4-[2-ethyl-4-(4-fluorophenyl)phenyl]-2,2-dimethyl-1-oxaspiro[5.5]undecane-3,5-dione |
| SMILES | CCc1cc(-c2ccc(F)cc2)ccc1C1C(=O)C(C)(C)OC2(CCCCC2)C1=O |
| InChI | InChI=1S/C26H29FO3/c1-4-17-16-19(18-8-11-20(27)12-9-18)10-13-21(17)22-23(28)25(2,3)30-26(24(22)29)14-6-5-7-15-26/h8-13,16,22H,4-7,14-15H2,1-3H3 |
| InChIKey | NBDOOTZOIOLWDS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|