C18H25ClO — CID 134959293
4-(4-chlorophenyl)-3,6-diethylocta-4,5-dien-3-ol (PubChem CID 134959293) has the molecular formula C18H25ClO and a molecular weight of 292.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3,6-diethylocta-4,5-dien-3-ol.
| Compound Name | 4-(4-chlorophenyl)-3,6-diethylocta-4,5-dien-3-ol |
|---|---|
| PubChem CID | 134959293 |
| Molecular Formula | C18H25ClO |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-(4-chlorophenyl)-3,6-diethylocta-4,5-dien-3-ol |
| SMILES | CCC(=C=C(c1ccc(Cl)cc1)C(O)(CC)CC)CC |
| InChI | InChI=1S/C18H25ClO/c1-5-14(6-2)13-17(18(20,7-3)8-4)15-9-11-16(19)12-10-15/h9-12,20H,5-8H2,1-4H3 |
| InChIKey | IELPXSDFJVFEEQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |