C33H37N3O2 — CID 134959311
5-[2-[3-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]iminocyclohexen-1-yl]ethyl]benzene-1,3-diol (PubChem CID 134959311) has the molecular formula C33H37N3O2 and a molecular weight of 507.68 g/mol. Its IUPAC name is 5-[2-[3-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]iminocyclohexen-1-yl]ethyl]benzene-1,3-diol.
| Compound Name | 5-[2-[3-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]iminocyclohexen-1-yl]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 134959311 |
| Molecular Formula | C33H37N3O2 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 5-[2-[3-[(S)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-quinolin-4-ylmethyl]iminocyclohexen-1-yl]ethyl]benzene-1,3-diol |
| SMILES | C=CC1CN2CCC1CC2[C@@H](/N=C1/C=C(CCc2cc(O)cc(O)c2)CCC1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C33H37N3O2/c1-2-24-21-36-15-13-25(24)19-32(36)33(30-12-14-34-31-9-4-3-8-29(30)31)35-26-7-5-6-22(16-26)10-11-23-17-27(37)20-28(38)18-23/h2-4,8-9,12,14,16-18,20,24-25,32-33,37-38H,1,5-7,10-11,13,15,19,21H2/b35-26+/t24?,25?,32?,33-/m0/s1 |
| InChIKey | GEDOTTVYXJJMBY-MJRDXQLDSA-N |
| XLogP | 6.77 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|