C23H36OSi — CID 134959745
tri(propan-2-yl)-[[(1S,9R,10R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl]oxy]silane (PubChem CID 134959745) has the molecular formula C23H36OSi and a molecular weight of 356.63 g/mol. Its IUPAC name is tri(propan-2-yl)-[[(1S,9R,10R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl]oxy]silane.
| Compound Name | tri(propan-2-yl)-[[(1S,9R,10R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl]oxy]silane |
|---|---|
| PubChem CID | 134959745 |
| Molecular Formula | C23H36OSi |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tri(propan-2-yl)-[[(1S,9R,10R)-9-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl]oxy]silane |
| SMILES | CC(C)[Si](O[C@H]1c2ccccc2C2[C@H]3CCC(C3)[C@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36OSi/c1-14(2)25(15(3)4,16(5)6)24-23-20-10-8-7-9-19(20)21-17-11-12-18(13-17)22(21)23/h7-10,14-18,21-23H,11-13H2,1-6H3/t17-,18?,21?,22+,23-/m0/s1 |
| InChIKey | JWMBZGCXGOGZLP-XJZKUGEMSA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|