C26H25NO4 — CID 134959828
dimethyl (4aS,9aS)-2-benzyl-3,4a,9,9a-tetrahydro-1H-indeno[2,1-f]isoindole-4,10-dicarboxylate (PubChem CID 134959828) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is dimethyl (4aS,9aS)-2-benzyl-3,4a,9,9a-tetrahydro-1H-indeno[2,1-f]isoindole-4,10-dicarboxylate.
| Compound Name | dimethyl (4aS,9aS)-2-benzyl-3,4a,9,9a-tetrahydro-1H-indeno[2,1-f]isoindole-4,10-dicarboxylate |
|---|---|
| PubChem CID | 134959828 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | dimethyl (4aS,9aS)-2-benzyl-3,4a,9,9a-tetrahydro-1H-indeno[2,1-f]isoindole-4,10-dicarboxylate |
| SMILES | COC(=O)C1=C2CN(Cc3ccccc3)CC2=C(C(=O)OC)[C@@H]2c3ccccc3C[C@H]12 |
| InChI | InChI=1S/C26H25NO4/c1-30-25(28)23-19-12-17-10-6-7-11-18(17)22(19)24(26(29)31-2)21-15-27(14-20(21)23)13-16-8-4-3-5-9-16/h3-11,19,22H,12-15H2,1-2H3/t19-,22+/m0/s1 |
| InChIKey | HSCMXUGTRDMSBO-SIKLNZKXSA-N |
| XLogP | 3.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |