C21H17N3O3 — CID 134959994
benzyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-phenylacetate (PubChem CID 134959994) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is benzyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-phenylacetate.
| Compound Name | benzyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 134959994 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | benzyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-phenylacetate |
| SMILES | N#C[C@](C(=O)OCc1ccccc1)(c1ccccc1)N(O)c1ccccn1 |
| InChI | InChI=1S/C21H17N3O3/c22-16-21(18-11-5-2-6-12-18,24(26)19-13-7-8-14-23-19)20(25)27-15-17-9-3-1-4-10-17/h1-14,26H,15H2/t21-/m1/s1 |
| InChIKey | UVJMVMUKZDPUTB-OAQYLSRUSA-N |
| XLogP | 3.44 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|