C19H21N3O4 — CID 134960000
tert-butyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-(3-methoxyphenyl)acetate (PubChem CID 134960000) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-(3-methoxyphenyl)acetate.
| Compound Name | tert-butyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 134960000 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | tert-butyl (2S)-2-cyano-2-[hydroxy(pyridin-2-yl)amino]-2-(3-methoxyphenyl)acetate |
| SMILES | COc1cccc([C@](C#N)(C(=O)OC(C)(C)C)N(O)c2ccccn2)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-18(2,3)26-17(23)19(13-20,14-8-7-9-15(12-14)25-4)22(24)16-10-5-6-11-21-16/h5-12,24H,1-4H3/t19-/m1/s1 |
| InChIKey | BLLXVQMFHZRPFM-LJQANCHMSA-N |
| XLogP | 3.05 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|