C18H18FN3O3 — CID 134959998
tert-butyl (2S)-2-cyano-2-(3-fluorophenyl)-2-[hydroxy(pyridin-2-yl)amino]acetate (PubChem CID 134959998) has the molecular formula C18H18FN3O3 and a molecular weight of 343.36 g/mol. Its IUPAC name is tert-butyl (2S)-2-cyano-2-(3-fluorophenyl)-2-[hydroxy(pyridin-2-yl)amino]acetate.
| Compound Name | tert-butyl (2S)-2-cyano-2-(3-fluorophenyl)-2-[hydroxy(pyridin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 134959998 |
| Molecular Formula | C18H18FN3O3 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | tert-butyl (2S)-2-cyano-2-(3-fluorophenyl)-2-[hydroxy(pyridin-2-yl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)[C@@](C#N)(c1cccc(F)c1)N(O)c1ccccn1 |
| InChI | InChI=1S/C18H18FN3O3/c1-17(2,3)25-16(23)18(12-20,13-7-6-8-14(19)11-13)22(24)15-9-4-5-10-21-15/h4-11,24H,1-3H3/t18-/m1/s1 |
| InChIKey | YYSFBZJNKNBPQZ-GOSISDBHSA-N |
| XLogP | 3.18 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|