C28H32FN5O2 — CID 54256929
tert-butyl 2-[4-[5-(4-carbamimidoylphenyl)-2-pyridinyl]piperazin-1-yl]-2-(4-fluorophenyl)acetate (PubChem CID 54256929) has the molecular formula C28H32FN5O2 and a molecular weight of 489.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[5-(4-carbamimidoylphenyl)-2-pyridinyl]piperazin-1-yl]-2-(4-fluorophenyl)acetate.
| Compound Name | tert-butyl 2-[4-[5-(4-carbamimidoylphenyl)-2-pyridinyl]piperazin-1-yl]-2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 54256929 |
| Molecular Formula | C28H32FN5O2 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | tert-butyl 2-[4-[5-(4-carbamimidoylphenyl)-2-pyridinyl]piperazin-1-yl]-2-(4-fluorophenyl)acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(N3CCN(C(C(=O)OC(C)(C)C)c4ccc(F)cc4)CC3)nc2)cc1 |
| InChI | InChI=1S/C28H32FN5O2/c1-28(2,3)36-27(35)25(20-8-11-23(29)12-9-20)34-16-14-33(15-17-34)24-13-10-22(18-32-24)19-4-6-21(7-5-19)26(30)31/h4-13,18,25H,14-17H2,1-3H3,(H3,30,31) |
| InChIKey | RASMAOXNXCKZTN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 95.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|