C21H23FN2O2 — CID 155761097
tert-butyl 2-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]acetate (PubChem CID 155761097) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is tert-butyl 2-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]acetate.
| Compound Name | tert-butyl 2-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]acetate |
|---|---|
| PubChem CID | 155761097 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl 2-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]acetate |
| SMILES | [C-]#[N+]c1cc(-c2cc(F)cc(C(C)C)c2CC(=O)OC(C)(C)C)ccn1 |
| InChI | InChI=1S/C21H23FN2O2/c1-13(2)16-10-15(22)11-17(14-7-8-24-19(9-14)23-6)18(16)12-20(25)26-21(3,4)5/h7-11,13H,12H2,1-5H3 |
| InChIKey | FPXMMMZRPBPFSY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 43.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|