C17H11F5N2O3 — CID 54255767
ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate (PubChem CID 54255767) has the molecular formula C17H11F5N2O3 and a molecular weight of 386.28 g/mol. Its IUPAC name is ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate.
| Compound Name | ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate |
|---|---|
| PubChem CID | 54255767 |
| Molecular Formula | C17H11F5N2O3 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,3,4,5-tetrafluorophenyl)propanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cn1)C(=O)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H11F5N2O3/c1-2-27-17(26)10(7-24-12-4-3-8(18)6-23-12)16(25)9-5-11(19)14(21)15(22)13(9)20/h3-7,10H,2H2,1H3/b24-7+ |
| InChIKey | QZYMWQBJKFAOTQ-HCBMXOAHSA-N |
| XLogP | 3.54 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|