4-oxo-3H-1,8-naphthyridine-3-carboxylic acid

C9H6N2O3 — CID 69490764

IUPAC4-oxo-3H-1,8-naphthyridine-3-carboxylic acid
SMILESO=C(O)C1C=Nc2ncccc2C1=O
InChIInChI=1S/C9H6N2O3/c12-7-5-2-1-3-10-8(5)11-4-6(7)9(13)14/h1-4,6H,(H,13,14)
InChIKeyZMMAJVZOYAEFNK-UHFFFAOYSA-N
MW190.16 g/mol
LogP0.68
Rot. Bonds1

About 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid

4-oxo-3H-1,8-naphthyridine-3-carboxylic acid (PubChem CID 69490764) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-oxo-3H-1,8-naphthyridine-3-carboxylic acid
PubChem CID69490764
Molecular FormulaC9H6N2O3
Molecular Weight190.16 g/mol
Exact Mass190.04
IUPAC Name4-oxo-3H-1,8-naphthyridine-3-carboxylic acid
SMILESO=C(O)C1C=Nc2ncccc2C1=O
InChIInChI=1S/C9H6N2O3/c12-7-5-2-1-3-10-8(5)11-4-6(7)9(13)14/h1-4,6H,(H,13,14)
InChIKeyZMMAJVZOYAEFNK-UHFFFAOYSA-N
XLogP0.68
TPSA79.62 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 50.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid?
The IUPAC name of 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid (CID 69490764) is 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid?
The canonical SMILES for 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid is O=C(O)C1C=Nc2ncccc2C1=O.
What is the InChIKey of 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid?
The InChIKey is ZMMAJVZOYAEFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-7-5-2-1-3-10-8(5)11-4-6(7)9(13)14/h1-4,6H,(H,13,14).
What are the key properties of 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid?
4-oxo-3H-1,8-naphthyridine-3-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3H-1,8-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 69490764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).